![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | if americans knew/ | 2024-11-06 22:15 | - | |
![[VID]](/icons/movie.gif) | _The Palestinian issue is a fake issue._ Headlines From Palestine 12_19.mp4 | 2021-12-02 12:34 | 66M | |
| _Our Common Bond_ – San Francisco Jewish Community Federation.mp4 | 2021-12-04 09:58 | 44M | |
| _Gaza the Broken Hearted_ by Chris Hedges - If Americans Knew.mp4 | 2021-12-04 10:05 | 20M | |
| Zeid Fadel Qaisiyya, 15, RIP.mp4 | 2021-12-02 11:05 | 14M | |
| Zakaria al Kafarneh.mp4 | 2021-12-02 12:39 | 6.1M | |
| Your Stimulus Checks Are Going To Israel.mp4 | 2021-12-02 11:04 | 47M | |
| Worst Propaganda Ever_.mp4 | 2021-12-02 13:05 | 104M | |
| World Holocaust Forum 2020.mp4 | 2021-12-02 21:49 | 1.2G | |
| Women Destroy Civilization.mp4 | 2021-12-03 10:23 | 18M | |
| What they aren't telling you about Iran, Israel, U.S. and nukes.mp4 | 2021-12-02 12:54 | 74M | |
| Video screened at UN Human Rights Council meeting February 28 2019.mp4 | 2021-12-02 22:01 | 38M | |
| US Policies_ Made In Israel.mp4 | 2021-12-04 10:07 | 57M | |
| UN Video Gaza Teenagers Shot By Israeli Snipers.mp4 | 2021-12-02 21:58 | 64M | |
| Trump administrations' peace plan.mp4 | 2021-12-02 11:12 | 45M | |
| Top CIA analyst explains Israel's destructive role in US policies.mp4 | 2021-12-02 21:40 | 148M | |
| The War Party (BBC Panorama) - If Americans Knew.mp4 | 2021-12-04 10:05 | 134M | |
| The Lobby USA part 3.mp4 | 2021-12-03 06:06 | 567M | |
| The Lobby USA part 2.mp4 | 2021-12-02 22:38 | 389M | |
| The Lobby USA part 1.mp4 | 2021-12-02 22:38 | 482M | |
| The Lobby USA - Abridged.mp4 | 2021-12-02 22:15 | 770M | |
| The Israel lobby's power over Congress_ Both parties obey.mp4 | 2021-12-02 14:47 | 63M | |
| The Israel Lobby in the Britain - Documentary by Al Jazeera (Part 4 of 4).mp4 | 2021-12-03 11:50 | 569M | |
| The Israel Lobby in Britain - Documentary by Al Jazeera (Part 3 of 4).mp4 | 2021-12-03 11:22 | 318M | |
| The Emasculation of White Male Identity.mp4 | 2021-12-02 12:06 | 12M | |
| The Easiest Targets (Part 2).mp4 | 2021-12-02 12:28 | 11M | |
| The Easiest Targets (Part 1).mp4 | 2021-12-02 12:28 | 18M | |
| The Easiest Targets (Excerpts).mp4 | 2021-12-02 12:28 | 22M | |
| The Apartheid System in Israel Shows Its Face Again.mp4 | 2021-12-02 12:46 | 55M | |
| The 5th World Holocaust Forum “Remembering the Holocaust Fighting Antisemitism_.mp4 | 2021-12-04 09:55 | 2.8G | |
| Tent Promo - Great Return March.mp4 | 2021-12-02 12:54 | 11M | |
| TV interview with Grace Halsell on her book _Journey to Jerusalem_.mp4 | 2021-12-02 21:22 | 9.0M | |
| THE PLEDGE TO ISRAEL.mp4 | 2021-12-02 21:56 | 23M | |
| Solar Storm - Turning the Talmudic Tide (11-21-21).mp4 | 2021-12-02 10:07 | 242M | |
| Should Zionists support a white ethno state (Mark Collett debate).mp4 | 2021-12-02 11:58 | 219M | |
| Sheldon Adelson regrets having worn an American uniform rather than an Israeli one.mp4 | 2021-12-04 09:57 | 3.8M | |
| Shah of Iran on the power of the 'Jewish Lobby' (60 Minutes interview by Mike Wallace).mp4 | 2021-12-02 21:29 | 7.4M | |
| Schumer, Pelosi, & Israeli billionaire Haim Saban at 2018 IAC conference.mp4 | 2021-12-02 22:06 | 805M | |
| Samantha Ravich speech at Israel Bonds event.mp4 | 2021-12-04 10:00 | 9.7M | |
| Russian Defector _ Arkady Shevchenko _ Cold War _ KGB _ TV Eye _ 1985.mp4 | 2021-12-02 16:28 | 119M | |
| Roman Abramovich's secret funding of Israeli settlements.mp4 | 2021-12-02 21:27 | 336M | |
| Response to Max Blumenthal remarks about Alison Weir.mp4 | 2021-12-02 12:31 | 21M | |
| Rabbi Schneerson urges Netanyahu to bring about the endtimes.mp4 | 2021-12-02 12:06 | 3.6M | |
| RIP Mahmoud and Maher.mp4 | 2021-12-02 12:34 | 11M | |
| RIP Mahmoud Zaal Odeh.mp4 | 2021-12-02 12:33 | 5.1M | |
| RAW FOOTAGE_ Rolf Harris and Jimmy Savile joke about their friendship (1992).mp4 | 2021-11-30 16:35 | 17M | |
| Professor Virginia Tilley speech at the First Global Conference on Israeli Apartheid.mp4 | 2021-12-02 21:38 | 157M | |
| Professor Virginia Tilley speech at the First Global Conference on Israeli Apartheid - with slides.mp4 | 2021-12-02 21:36 | 118M | |
| Professor Richard Falk speech at the First Global Conference on Israeli Apartheid.mp4 | 2021-12-02 21:33 | 92M | |
| Philip Giraldi - Is Israel a U.S. ally_.mp4 | 2021-12-02 21:49 | 47M | |
| Pete McCloskey Leading From The Front.mp4 | 2021-12-02 21:12 | 368M | |
| PayPal Discriminates Against Palestinians.mp4 | 2021-12-02 12:42 | 49M | |
| Palestinians' life under Israeli occupation_ Israeli soldiers describe their actions in Hebron.mp4 | 2021-12-02 16:33 | 239M | |
| Palestinian children killed by Israel_ The human dimension.mp4 | 2021-12-02 10:55 | 12M | |
| Palestinian Shot in the Back.mp4 | 2021-12-02 22:29 | 8.8M | |
| Palestinian Rockets_ The Hidden Facts.mp4 | 2021-12-02 10:59 | 53M | |
| Palestinian Refugee Crisis is Absurd.mp4 | 2021-12-02 12:43 | 71M | |
| Occupation 101_ Voices of the Silenced Majority.mp4 | 2021-12-02 14:32 | 1.1G | |
| Netanyahu, unaware of the camera, says 'America can easily be moved'.mp4 | 2021-12-04 10:01 | 3.6M | |
| Mohammad Salman el Haddad, 17, RIP.mp4 | 2021-12-02 11:04 | 7.2M | |
| Mohammad Damer Matar, 16, RIP.mp4 | 2021-12-02 11:03 | 12M | |
| Mohammad Abu Haddaf.mp4 | 2021-12-02 12:45 | 8.9M | |
| Mohammad Abdul Karim Hamayel, 15, RIP.mp4 | 2021-12-02 11:04 | 18M | |
| Mohamed Moheisen.mp4 | 2021-12-02 12:38 | 3.4M | |
| Mike Wallace reports on AIPAC and the Israel Lobby in US Politics - 1988..mp4 | 2021-12-04 09:58 | 43M | |
| Mel Gibson WARNED us about CHINA 30yrs AGO.mp4 | 2021-11-24 21:16 | 11M | |
| Matthew North telling you what I've been writing.mp4 | 2021-12-02 10:09 | 229M | |
| Matthew North Is Dead_.mp4 | 2021-12-03 10:13 | 5.5M | |
| Mahmoud Omar Sadeq Kamil, 17, RIP.mp4 | 2021-12-02 11:04 | 29M | |
| MASS MURDER IN GAZA.mp4 | 2021-12-02 13:00 | 39M | |
| MASSACRE IN GAZA (caution_ highly disturbing footage).mp4 | 2021-12-02 12:52 | 38M | |
| Luay and Amir.mp4 | 2021-12-02 13:38 | 49M | |
| Journalism is a crime in Israel.mp4 | 2021-12-02 13:38 | 29M | |
| Join Us For AIPAC Policy Conference (2014 video for West Virginians).mp4 | 2021-12-02 21:21 | 16M | |
| Jim Traficant - Israel has a stranglehold on Congress.mp4 | 2021-12-02 11:02 | 7.2M | |
| Jeffrey Goldberg_ Pundit for Israel.mp4 | 2021-12-02 12:32 | 18M | |
| JOE ROGAN IS A DRUG-ADDLED CIA SHILL w_RichieFromBoston Matthew North & Carter Edison.mp4 | 2021-12-02 10:10 | 81M | |
| JESUS GETS THREATS from Youtuber!!!.mp4 | 2021-12-03 10:19 | 287M | |
| Israel lobbyist describes ways to procure massive US aid to Israel, despite US recession.mp4 | 2021-12-02 21:28 | 5.9M | |
| Israeli war crimes.mp4 | 2021-02-03 18:48 | 3.4M | |
| Israel is Training U.S. Police.mp4 | 2021-12-02 21:26 | 26M | |
| Israel imprisons Palestinians for YEARS without charges or trial.mp4 | 2021-12-02 12:40 | 55M | |
| Israeli historian Ilan Pappé on the ethnic cleansing of Palestine.mp4 | 2021-12-02 21:31 | 6.2M | |
| Israeli Soldiers Target Children.mp4 | 2021-12-02 22:29 | 52M | |
| Israeli Soldiers Shooting Unarmed Palestinians.mp4 | 2021-12-02 21:40 | 60M | |
| Israeli Soldiers Shoot Child, Force False Confession To Cover.mp4 | 2021-12-02 12:46 | 78M | |
| Israeli Settlers Destroy Palestinians Ability to Live.mp4 | 2021-12-02 12:35 | 48M | |
| Israeli Arms Business is Booming.mp4 | 2021-12-02 21:24 | 65M | |
| Israel denies entry to US Congress members, despite receiving billions of dollars from the US..mp4 | 2021-12-02 21:47 | 6.2M | |
| Israel and the World Refugee Crisis SPANISH SUBTITLES.mp4 | 2021-12-02 11:06 | 47M | |
| Israel Uses Military Tech Industry to Spy on Americans.mp4 | 2021-12-02 21:19 | 31M | |
| Israel Uses Basketball Star Draymond Green For Propaganda.mp4 | 2021-12-02 13:10 | 53M | |
| Israel Uses Attack Dogs and Strip Searches of Women To Terrorize Palestinians.mp4 | 2021-12-02 12:44 | 60M | |
| Israel Palestine Beyond the Headlines (Alison Weir, Case Western Reserve).mp4 | 2021-12-02 21:54 | 240M | |
| Israel Palestine Basics_part1_2.mp4 | 2021-12-02 13:03 | 49M | |
| Israel Palestine Basics.mp4 | 2021-12-02 10:56 | 49M | |
| Israel Destroys Coronavirus Clinic.mp4 | 2021-12-02 11:11 | 63M | |
| Israel Bombs Children In Their Beds.mp4 | 2021-12-02 21:40 | 41M | |
| Israel Anti Boycott Act.mp4 | 2021-12-02 22:25 | 33M | |
| Israel's persecution of Khalida Jarrar, Member of Palestinian Parliament.mp4 | 2021-12-02 21:32 | 51M | |
| Israel's blockade of Gaza and the coronavirus.mp4 | 2021-12-02 11:11 | 23M | |
| Israel's 'investigations' of crimes against Palestinians are used to whitewash the violence.mp4 | 2021-12-02 21:27 | 27M | |
| Israel's 'Break the Bones' policy.mp4 | 2021-12-07 18:33 | 3.8M | |
| Israel & Mossad Links! __ The BANNED FOX News 9-11 Report.mp4 | 2021-12-07 15:32 | 31M | |
| Israel’s ”Antisemitism_ Cyber Monitoring System - If Americans Knew.mp4 | 2021-12-02 13:38 | 41M | |
| Ismael Saleh Abu Ryala.mp4 | 2021-12-02 12:46 | 19M | |
| Ilhan Omar - Someone Ours -Unafraid & Unapologetic - By Vigilante Intelligence aka Johnny Gat.mp4 | 2021-12-07 15:23 | 40M | |
| If Americans Knew_ Essential facts on Israel-Palestine & the U.S..mp4 | 2021-12-02 12:31 | 19M | |
| If Americans Knew By Ron Paul Israel created Hamas (see details).video.mp4 | 2021-12-02 16:31 | 6.2M | |
| If Americans Knew - Intro.mp4 | 2021-12-02 10:59 | 41M | |
| Ibrahim Abu Thuraya.mp4 | 2021-12-02 12:36 | 10M | |
| ISRAEL CONTINUES SLAUGHTER.mp4 | 2021-12-02 12:53 | 67M | |
| How are Palestinians reacting to the U S embassy in Jerusalem and violence in Gaza_.mp4 | 2021-12-02 13:00 | 44M | |
| How Pro Israel Neocons Pushed for War in Iraq (Alison Weir).mp4 | 2021-12-02 13:10 | 33M | |
| How Israel partisans buy U.S. elections.mp4 | 2021-12-02 13:44 | 91M | |
| How Amazon Supports Israeli Atrocities.mp4 | 2021-12-02 11:14 | 56M | |
| Hollywood raises funds for a foreign army - If Americans Knew.mp4 | 2021-12-02 12:39 | 24M | |
| Hind Gaza Report 5 11 18 - If Americans Knew.mp4 | 2021-12-02 12:54 | 30M | |
| Happy 70th birthday, Alison!.mp4 | 2021-12-02 12:33 | 38M | |
| Hannity and Traficant Get into Shouting Match Over Israel Lobby and U.S. Policy.mp4 | 2021-12-07 15:33 | 11M | |
| Hamda Zubeidat.mp4 | 2021-12-02 12:41 | 8.4M | |
| Great Return March.mp4 | 2021-12-02 12:52 | 24M | |
| Gazan rockets & Sderot_ Message to Congress member Manning.mp4 | 2021-12-02 11:02 | 104M | |
| Gaza_ The Killing Zone (Documentary).mp4 | 2021-12-02 12:33 | 169M | |
| Gaza Rockets_ How Israeli PR & US media reverse the reality.mp4 | 2021-12-02 21:50 | 54M | |
| Gaza After Disengagement.mp4 | 2021-12-02 12:30 | 6.6M | |
| Fresno's KSEE24_ Darius Assemi defends inviting Alison Weir to speak in Clovis.mp4 | 2021-12-02 21:45 | 41M | |
| Frankfurt School The Designed Eradication of Western Civilization.mp4 | 2021-12-02 12:05 | 27M | |
| Former Ohio Congressman Traficant_ 'Israel Controls America'.mp4 | 2021-12-02 21:10 | 13M | |
| Florida CBS News report on demonstration references If Americans Knew.mp4 | 2021-12-02 21:08 | 31M | |
| Expansion in East Jerusalem_ Jeff Halper & Alison Weir.mp4 | 2021-12-02 22:22 | 95M | |
| Enas and Bayan Khammash.mp4 | 2021-12-02 13:37 | 15M | |
| Double Amputee Killed By Israeli Sniper. Headlines From Palestine, December 18th 2017.mp4 | 2021-12-02 12:35 | 71M | |
| Documentary on Paul Findley, _Courage to Speak Out_ trailer.mp4 | 2021-12-02 22:24 | 14M | |
| Debunking Israel's Victim Card.mp4 | 2021-12-02 13:43 | 26M | |
| Deal of the Century.mp4 | 2021-12-02 22:27 | 13M | |
| Dalal Lulah.mp4 | 2021-12-02 12:41 | 3.1M | |
| Daily Life in Occupied Palestine.mp4 | 2021-12-02 11:08 | 181M | |
| Daily Life in Occupied Palestine - short version.mp4 | 2021-12-02 11:10 | 43M | |
| Cynthia McKinney US Lawmakers Forced to Sign Pledge to Support Israels.mp4 | 2021-12-02 21:55 | 23M | |
| Congress passes the 2021 NDAA, including $4 billion for Israel.mp4 | 2021-12-02 11:05 | 23M | |
| Congressman Pete McCloskey describes ADL bullying.mp4 | 2021-12-02 21:54 | 33M | |
| Congressman Gus Savage exposes facts about the Israel Lobby in speech to Congress.mp4 | 2021-12-04 10:00 | 157M | |
| Celebrities Simulate Killing Palestinians.mp4 | 2021-12-02 12:41 | 44M | |
| Captured Prisoners_ The Whole Story (Part I).mp4 | 2021-12-02 12:30 | 11M | |
| Captured Prisoners_ The Whole Story (Part 3).mp4 | 2021-12-02 12:29 | 11M | |
| Captured Prisoners_ The Whole Story (Part 2).mp4 | 2021-12-02 12:29 | 13M | |
| Captain Ward Boston's Testimony Regarding USS Liberty Cover Up.mp4 | 2021-12-02 21:07 | 44M | |
| Breaking Down Israeli Lies - e.g. repeated byTrevor Noah.mp4 | 2021-12-02 11:01 | 88M | |
| Atef al Maqousi.mp4 | 2021-12-02 12:32 | 5.1M | |
| Arkan Mezher.mp4 | 2021-12-02 13:18 | 22M | |
| Amir Abdul-Hamid Abu Mosa'ed.mp4 | 2021-12-02 12:43 | 10M | |
| Amer Abdul Rahim Snobar, 17, RIP.mp4 | 2021-12-02 11:05 | 13M | |
| Ambassador David Friedman addresses AIPAC in 2018.mp4 | 2021-12-04 09:55 | 27M | |
| Alison Weir interviews Nader Talebzadeh, chairman of Iran's New Horizon Conference.mp4 | 2021-12-02 11:17 | 310M | |
| Alison Weir and Jesse Ventura on Palestine.mp4 | 2021-12-04 09:49 | 87M | |
| Alison Weir_ Findings from her book 'Against Our Better Judgment'.mp4 | 2021-12-02 11:10 | 84M | |
| Ahmad Samir Abu Obeid.mp4 | 2021-12-02 12:44 | 6.9M | |
| Ahmad Nasser Jarrar.mp4 | 2021-12-02 12:43 | 11M | |
| A Week in the Life of a Palestinian Child -- October 3-9, 2019.mp4 | 2021-12-02 11:13 | 36M | |
| AP Erases Video of Israeli Soldier Shooting Palestinian Boy.mp4 | 2021-12-02 12:30 | 13M | |
| ANOTHER MASSACRE IN GAZA.mp4 | 2021-12-02 12:52 | 56M | |
| A History of Money in Palestine _ The Case of the Frozen Bank Accounts of 1948.mp4 | 2021-12-04 09:57 | 139M | |
| 20 Million Per Day on Behalf of Israel_ The Facts.mp4 | 2021-12-02 10:55 | 14M | |
| 'Progressives' Vote AGAINST BDS.mp4 | 2021-12-02 11:32 | 51M | |
|
|---|